About potassium cyano carbonate
potassium cyano carbonate (PubChem CID 23721505) has the molecular formula C2KNO3
and a molecular weight of 125.12 g/mol. Its IUPAC name is potassium cyano carbonate.
Molecular Properties
| Compound Name | potassium cyano carbonate |
| PubChem CID | 23721505 |
| Molecular Formula | C2KNO3 |
| Molecular Weight | 125.12 g/mol |
| Exact Mass | 124.95 |
| IUPAC Name | potassium cyano carbonate |
| SMILES | N#COC(=O)[O-].[K+] |
| InChI | InChI=1S/C2HNO3.K/c3-1-6-2(4)5;/h(H,4,5);/q;+1/p-1 |
| InChIKey | CDBJXCDHVRZACS-UHFFFAOYSA-M |
| XLogP | -4.17 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.12 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze potassium cyano carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium cyano carbonate?
The IUPAC name of potassium cyano carbonate (CID 23721505) is potassium cyano carbonate.
What is the SMILES notation for potassium cyano carbonate?
The canonical SMILES for potassium cyano carbonate is N#COC(=O)[O-].[K+].
What is the InChIKey of potassium cyano carbonate?
The InChIKey is CDBJXCDHVRZACS-UHFFFAOYSA-M. The full InChI is InChI=1S/C2HNO3.K/c3-1-6-2(4)5;/h(H,4,5);/q;+1/p-1.
What are the key properties of potassium cyano carbonate?
potassium cyano carbonate has a molecular weight of 125.12 g/mol, XLogP of -4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium cyano carbonate is sourced from PubChem (CID 23721505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).