C7H14NNaO4S — CID 23721817
sodium 2-hydroxy-3-pyrrolidin-1-ylpropane-1-sulfonate (PubChem CID 23721817) has the molecular formula C7H14NNaO4S and a molecular weight of 231.25 g/mol. Its IUPAC name is sodium 2-hydroxy-3-pyrrolidin-1-ylpropane-1-sulfonate.
| Compound Name | sodium 2-hydroxy-3-pyrrolidin-1-ylpropane-1-sulfonate |
|---|---|
| PubChem CID | 23721817 |
| Molecular Formula | C7H14NNaO4S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | sodium 2-hydroxy-3-pyrrolidin-1-ylpropane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(O)CN1CCCC1.[Na+] |
| InChI | InChI=1S/C7H15NO4S.Na/c9-7(6-13(10,11)12)5-8-3-1-2-4-8;/h7,9H,1-6H2,(H,10,11,12);/q;+1/p-1 |
| InChIKey | PALUCVBXLKEBHC-UHFFFAOYSA-M |
| XLogP | -4.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|