N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid

C23H25NO4 — CID 23724189

IUPACN-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid
SMILESCC(CCc1ccccc1)NCc1cccc2ccccc12.O=C(O)C(=O)O
InChIInChI=1S/C21H23N.C2H2O4/c1-17(14-15-18-8-3-2-4-9-18)22-16-20-12-7-11-19-10-5-6-13-21(19)20;3-1(4)2(5)6/h2-13,17,22H,14-16H2,1H3;(H,3,4)(H,5,6)
InChIKeyXMWZPEUSBBTIQL-UHFFFAOYSA-N
MW379.46 g/mol
LogP4.11
Rot. Bonds6

About N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid

N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid (PubChem CID 23724189) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid.

Molecular Properties

Compound NameN-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid
PubChem CID23724189
Molecular FormulaC23H25NO4
Molecular Weight379.46 g/mol
Exact Mass379.18
IUPAC NameN-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid
SMILESCC(CCc1ccccc1)NCc1cccc2ccccc12.O=C(O)C(=O)O
InChIInChI=1S/C21H23N.C2H2O4/c1-17(14-15-18-8-3-2-4-9-18)22-16-20-12-7-11-19-10-5-6-13-21(19)20;3-1(4)2(5)6/h2-13,17,22H,14-16H2,1H3;(H,3,4)(H,5,6)
InChIKeyXMWZPEUSBBTIQL-UHFFFAOYSA-N
XLogP4.11
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms28
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.46
LogP ≤ 54.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid?
The IUPAC name of N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid (CID 23724189) is N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid.
What is the SMILES notation for N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid?
The canonical SMILES for N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid is CC(CCc1ccccc1)NCc1cccc2ccccc12.O=C(O)C(=O)O.
What is the InChIKey of N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid?
The InChIKey is XMWZPEUSBBTIQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N.C2H2O4/c1-17(14-15-18-8-3-2-4-9-18)22-16-20-12-7-11-19-10-5-6-13-21(19)20;3-1(4)2(5)6/h2-13,17,22H,14-16H2,1H3;(H,3,4)(H,5,6).
What are the key properties of N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid?
N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid has a molecular weight of 379.46 g/mol, XLogP of 4.11, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(naphthalen-1-ylmethyl)-4-phenylbutan-2-amine;oxalic acid is sourced from PubChem (CID 23724189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).