C27H36N2O8 — CID 6433545
bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-piperidin-1-ium-1-ylethyl)azanium (PubChem CID 6433545) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-piperidin-1-ium-1-ylethyl)azanium.
| Compound Name | bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-piperidin-1-ium-1-ylethyl)azanium |
|---|---|
| PubChem CID | 6433545 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-piperidin-1-ium-1-ylethyl)azanium |
| SMILES | C/C=C/CC(C[NH2+]CC[NH+]1CCCCC1)c1cccc2ccccc12.O=C([O-])C(=O)O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C23H32N2.2C2H2O4/c1-2-3-10-21(19-24-15-18-25-16-7-4-8-17-25)23-14-9-12-20-11-5-6-13-22(20)23;2*3-1(4)2(5)6/h2-3,5-6,9,11-14,21,24H,4,7-8,10,15-19H2,1H3;2*(H,3,4)(H,5,6)/b3-2+;; |
| InChIKey | BGDVNEKYMWDDPK-WTVBWJGASA-N |
| XLogP | -1.84 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|