C28H38N2O10 — CID 25169
bis(2-hydroxy-2-oxoacetate);2-morpholin-4-ium-4-ylethyl-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azanium (PubChem CID 25169) has the molecular formula C28H38N2O10 and a molecular weight of 562.62 g/mol. Its IUPAC name is bis(2-hydroxy-2-oxoacetate);2-morpholin-4-ium-4-ylethyl-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azanium.
| Compound Name | bis(2-hydroxy-2-oxoacetate);2-morpholin-4-ium-4-ylethyl-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azanium |
|---|---|
| PubChem CID | 25169 |
| Molecular Formula | C28H38N2O10 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | bis(2-hydroxy-2-oxoacetate);2-morpholin-4-ium-4-ylethyl-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azanium |
| SMILES | O=C([O-])C(=O)O.O=C([O-])C(=O)O.c1ccc2c(CC(C[NH2+]CC[NH+]3CCOCC3)CC3CCCO3)cccc2c1 |
| InChI | InChI=1S/C24H34N2O2.2C2H2O4/c1-2-9-24-21(5-1)6-3-7-22(24)17-20(18-23-8-4-14-28-23)19-25-10-11-26-12-15-27-16-13-26;2*3-1(4)2(5)6/h1-3,5-7,9,20,23,25H,4,8,10-19H2;2*(H,3,4)(H,5,6) |
| InChIKey | MGXLTDLYHKGNMG-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 194.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|