C26H35NO5S — CID 27103
2-hydroxy-2-oxoacetate;2-naphthalen-1-yl-3-[5-(2-piperidin-1-ium-1-ylethyl)oxolan-2-yl]propane-1-thiol (PubChem CID 27103) has the molecular formula C26H35NO5S and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;2-naphthalen-1-yl-3-[5-(2-piperidin-1-ium-1-ylethyl)oxolan-2-yl]propane-1-thiol.
| Compound Name | 2-hydroxy-2-oxoacetate;2-naphthalen-1-yl-3-[5-(2-piperidin-1-ium-1-ylethyl)oxolan-2-yl]propane-1-thiol |
|---|---|
| PubChem CID | 27103 |
| Molecular Formula | C26H35NO5S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;2-naphthalen-1-yl-3-[5-(2-piperidin-1-ium-1-ylethyl)oxolan-2-yl]propane-1-thiol |
| SMILES | O=C([O-])C(=O)O.SCC(CC1CCC(CC[NH+]2CCCCC2)O1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H33NOS.C2H2O4/c27-18-20(24-10-6-8-19-7-2-3-9-23(19)24)17-22-12-11-21(26-22)13-16-25-14-4-1-5-15-25;3-1(4)2(5)6/h2-3,6-10,20-22,27H,1,4-5,11-18H2;(H,3,4)(H,5,6) |
| InChIKey | AUVFBVJLDSKFHU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|