C27H37NO5S — CID 27168
2-hydroxy-2-oxoacetate;2-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]sulfanylethyl]piperidin-1-ium (PubChem CID 27168) has the molecular formula C27H37NO5S and a molecular weight of 487.66 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;2-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]sulfanylethyl]piperidin-1-ium.
| Compound Name | 2-hydroxy-2-oxoacetate;2-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]sulfanylethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 27168 |
| Molecular Formula | C27H37NO5S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;2-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]sulfanylethyl]piperidin-1-ium |
| SMILES | O=C([O-])C(=O)O.c1ccc2c(CC(CSCCC3CCCC[NH2+]3)CC3CCCO3)cccc2c1 |
| InChI | InChI=1S/C25H35NOS.C2H2O4/c1-2-12-25-21(7-1)8-5-9-22(25)17-20(18-24-11-6-15-27-24)19-28-16-13-23-10-3-4-14-26-23;3-1(4)2(5)6/h1-2,5,7-9,12,20,23-24,26H,3-4,6,10-11,13-19H2;(H,3,4)(H,5,6) |
| InChIKey | PCMQZBHZZIADHZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|