C28H40N2O9 — CID 25343
diethyl-[2-[[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azaniumyl]ethyl]azanium;bis(2-hydroxy-2-oxoacetate) (PubChem CID 25343) has the molecular formula C28H40N2O9 and a molecular weight of 548.63 g/mol. Its IUPAC name is diethyl-[2-[[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azaniumyl]ethyl]azanium;bis(2-hydroxy-2-oxoacetate).
| Compound Name | diethyl-[2-[[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azaniumyl]ethyl]azanium;bis(2-hydroxy-2-oxoacetate) |
|---|---|
| PubChem CID | 25343 |
| Molecular Formula | C28H40N2O9 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | diethyl-[2-[[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propyl]azaniumyl]ethyl]azanium;bis(2-hydroxy-2-oxoacetate) |
| SMILES | CC[NH+](CC)CC[NH2+]CC(Cc1cccc2ccccc12)CC1CCCO1.O=C([O-])C(=O)O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C24H36N2O.2C2H2O4/c1-3-26(4-2)15-14-25-19-20(18-23-12-8-16-27-23)17-22-11-7-10-21-9-5-6-13-24(21)22;2*3-1(4)2(5)6/h5-7,9-11,13,20,23,25H,3-4,8,12,14-19H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | JRIVGOVAKQFYCR-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 185.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|