C26H34N2O8 — CID 6433543
bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-pyrrolidin-1-ium-2-ylethyl)azanium (PubChem CID 6433543) has the molecular formula C26H34N2O8 and a molecular weight of 502.56 g/mol. Its IUPAC name is bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-pyrrolidin-1-ium-2-ylethyl)azanium.
| Compound Name | bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-pyrrolidin-1-ium-2-ylethyl)azanium |
|---|---|
| PubChem CID | 6433543 |
| Molecular Formula | C26H34N2O8 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | bis(2-hydroxy-2-oxoacetate);[(E)-2-naphthalen-1-ylhex-4-enyl]-(2-pyrrolidin-1-ium-2-ylethyl)azanium |
| SMILES | C/C=C/CC(C[NH2+]CCC1CCC[NH2+]1)c1cccc2ccccc12.O=C([O-])C(=O)O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C22H30N2.2C2H2O4/c1-2-3-8-19(17-23-16-14-20-11-7-15-24-20)22-13-6-10-18-9-4-5-12-21(18)22;2*3-1(4)2(5)6/h2-6,9-10,12-13,19-20,23-24H,7-8,11,14-17H2,1H3;2*(H,3,4)(H,5,6)/b3-2+;; |
| InChIKey | JGHUASSFILXUFA-WTVBWJGASA-N |
| XLogP | -1.79 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|