C22H25F3N2O5 — CID 87621807
oxalic acid;2,2,2-trifluoro-1-[3-methyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]ethanone (PubChem CID 87621807) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is oxalic acid;2,2,2-trifluoro-1-[3-methyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]ethanone.
| Compound Name | oxalic acid;2,2,2-trifluoro-1-[3-methyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 87621807 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | oxalic acid;2,2,2-trifluoro-1-[3-methyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]ethanone |
| SMILES | CC1CN(C(=O)C(F)(F)F)CC1CN[C@H](C)c1cccc2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23F3N2O.C2H2O4/c1-13-11-25(19(26)20(21,22)23)12-16(13)10-24-14(2)17-9-5-7-15-6-3-4-8-18(15)17;3-1(4)2(5)6/h3-9,13-14,16,24H,10-12H2,1-2H3;(H,3,4)(H,5,6)/t13?,14-,16?;/m1./s1 |
| InChIKey | CAWXIOGHXJIOCB-RWGLBVRGSA-N |
| XLogP | 3.30 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|