C19H28BrF3O4Si — CID 23726098
methyl (3R)-5-(5-bromo-2-methoxyphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate (PubChem CID 23726098) has the molecular formula C19H28BrF3O4Si and a molecular weight of 485.41 g/mol. Its IUPAC name is methyl (3R)-5-(5-bromo-2-methoxyphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate.
| Compound Name | methyl (3R)-5-(5-bromo-2-methoxyphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate |
|---|---|
| PubChem CID | 23726098 |
| Molecular Formula | C19H28BrF3O4Si |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | methyl (3R)-5-(5-bromo-2-methoxyphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate |
| SMILES | COC(=O)C[C@@](CC(C)(C)c1cc(Br)ccc1OC)(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H28BrF3O4Si/c1-17(2,14-10-13(20)8-9-15(14)25-3)12-18(19(21,22)23,11-16(24)26-4)27-28(5,6)7/h8-10H,11-12H2,1-7H3/t18-/m0/s1 |
| InChIKey | IPWDUYQZIPGHOB-SFHVURJKSA-N |
| XLogP | 5.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|