C19H28F4O3Si — CID 58509553
methyl (3R)-5-(5-fluoro-2-methylphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate (PubChem CID 58509553) has the molecular formula C19H28F4O3Si and a molecular weight of 408.51 g/mol. Its IUPAC name is methyl (3R)-5-(5-fluoro-2-methylphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate.
| Compound Name | methyl (3R)-5-(5-fluoro-2-methylphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate |
|---|---|
| PubChem CID | 58509553 |
| Molecular Formula | C19H28F4O3Si |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | methyl (3R)-5-(5-fluoro-2-methylphenyl)-5-methyl-3-(trifluoromethyl)-3-trimethylsilyloxyhexanoate |
| SMILES | COC(=O)C[C@@](CC(C)(C)c1cc(F)ccc1C)(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H28F4O3Si/c1-13-8-9-14(20)10-15(13)17(2,3)12-18(19(21,22)23,11-16(24)25-4)26-27(5,6)7/h8-10H,11-12H2,1-7H3/t18-/m0/s1 |
| InChIKey | VSKMOSMETZHXRO-SFHVURJKSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|