C22H23N5O2S — CID 23726435
2-[1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]propanedinitrile (PubChem CID 23726435) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-[1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]propanedinitrile.
| Compound Name | 2-[1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]propanedinitrile |
|---|---|
| PubChem CID | 23726435 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-[1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl-(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]propanedinitrile |
| SMILES | CN1C(=O)C(C(c2cc3c4c(c2)CCCN4CCC3)C(C#N)C#N)C(=O)N(C)C1=S |
| InChI | InChI=1S/C22H23N5O2S/c1-25-20(28)18(21(29)26(2)22(25)30)17(16(11-23)12-24)15-9-13-5-3-7-27-8-4-6-14(10-15)19(13)27/h9-10,16-18H,3-8H2,1-2H3 |
| InChIKey | HHHZUJZGIKJMKH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|