C18H21N3O — CID 139475690
(5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2,3-dimethylimidazol-4-one (PubChem CID 139475690) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is (5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2,3-dimethylimidazol-4-one.
| Compound Name | (5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2,3-dimethylimidazol-4-one |
|---|---|
| PubChem CID | 139475690 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2,3-dimethylimidazol-4-one |
| SMILES | CC1=N/C(=C\c2cc3c4c(c2)CCCN4CCC3)C(=O)N1C |
| InChI | InChI=1S/C18H21N3O/c1-12-19-16(18(22)20(12)2)11-13-9-14-5-3-7-21-8-4-6-15(10-13)17(14)21/h9-11H,3-8H2,1-2H3/b16-11- |
| InChIKey | OKTDAJLGZDQKDX-WJDWOHSUSA-N |
| XLogP | 2.62 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|