C20H25N3O — CID 158513177
(5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-methyl-3-propylimidazol-4-one (PubChem CID 158513177) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-methyl-3-propylimidazol-4-one.
| Compound Name | (5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-methyl-3-propylimidazol-4-one |
|---|---|
| PubChem CID | 158513177 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (5Z)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-methyl-3-propylimidazol-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc3c4c(c2)CCCN4CCC3)N=C1C |
| InChI | InChI=1S/C20H25N3O/c1-3-8-23-14(2)21-18(20(23)24)13-15-11-16-6-4-9-22-10-5-7-17(12-15)19(16)22/h11-13H,3-10H2,1-2H3/b18-13- |
| InChIKey | HLHSKUIHSRENJS-AQTBWJFISA-N |
| XLogP | 3.40 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|