C24H26N2O — CID 58621787
(2E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-propylindol-3-one (PubChem CID 58621787) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is (2E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-propylindol-3-one.
| Compound Name | (2E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-propylindol-3-one |
|---|---|
| PubChem CID | 58621787 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-propylindol-3-one |
| SMILES | CCCN1/C(=C/c2cc3c4c(c2)CCCN4CCC3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H26N2O/c1-2-11-26-21-10-4-3-9-20(21)24(27)22(26)16-17-14-18-7-5-12-25-13-6-8-19(15-17)23(18)25/h3-4,9-10,14-16H,2,5-8,11-13H2,1H3/b22-16+ |
| InChIKey | VSMXTELGIVSMCQ-CJLVFECKSA-N |
| XLogP | 4.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|