C23H24N2O — CID 58795409
(3Z)-3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-ethylindol-2-one (PubChem CID 58795409) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (3Z)-3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-ethylindol-2-one.
| Compound Name | (3Z)-3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-ethylindol-2-one |
|---|---|
| PubChem CID | 58795409 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3Z)-3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cc3c4c(c2)CCCN4CCC3)c2ccccc21 |
| InChI | InChI=1S/C23H24N2O/c1-2-25-21-10-4-3-9-19(21)20(23(25)26)15-16-13-17-7-5-11-24-12-6-8-18(14-16)22(17)24/h3-4,9-10,13-15H,2,5-8,11-12H2,1H3/b20-15- |
| InChIKey | LVDNRGMMCFUIRN-HKWRFOASSA-N |
| XLogP | 4.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|