C24H28N2O2S — CID 143714927
(5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[(4Z,6Z)-octa-4,6-dienyl]-1,3-thiazolidine-2,4-dione (PubChem CID 143714927) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is (5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[(4Z,6Z)-octa-4,6-dienyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[(4Z,6Z)-octa-4,6-dienyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143714927 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[(4Z,6Z)-octa-4,6-dienyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C/C=C\C=C/CCCN1C(=O)S/C(=C/c2cc3c4c(c2)CCCN4CCC3)C1=O |
| InChI | InChI=1S/C24H28N2O2S/c1-2-3-4-5-6-7-14-26-23(27)21(29-24(26)28)17-18-15-19-10-8-12-25-13-9-11-20(16-18)22(19)25/h2-5,15-17H,6-14H2,1H3/b3-2-,5-4-,21-17+ |
| InChIKey | LFUSQVBPCGIBDG-BRXOWDNWSA-N |
| XLogP | 5.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|