C18H18N2O3S2 — CID 123992202
5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-ethenylperoxy-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123992202) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-ethenylperoxy-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-ethenylperoxy-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123992202 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-ethenylperoxy-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=COON1C(=O)C(=Cc2cc3c4c(c2)CCCN4CCC3)SC1=S |
| InChI | InChI=1S/C18H18N2O3S2/c1-2-22-23-20-17(21)15(25-18(20)24)11-12-9-13-5-3-7-19-8-4-6-14(10-12)16(13)19/h2,9-11H,1,3-8H2 |
| InChIKey | UMYWYJQKUPLOFV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|