C24H24F4N4O3S — CID 23726504
1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-11-(2,2,2-trifluoroacetyl)-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 23726504) has the molecular formula C24H24F4N4O3S and a molecular weight of 524.54 g/mol. Its IUPAC name is 1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-11-(2,2,2-trifluoroacetyl)-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-11-(2,2,2-trifluoroacetyl)-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 23726504 |
| Molecular Formula | C24H24F4N4O3S |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-11-(2,2,2-trifluoroacetyl)-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | CCSc1cc2c(cc1NC(=O)Nc1ccc(F)cc1)NC(=O)[C@@H]1CCCC[C@@H]1N2C(=O)C(F)(F)F |
| InChI | InChI=1S/C24H24F4N4O3S/c1-2-36-20-12-19-16(11-17(20)31-23(35)29-14-9-7-13(25)8-10-14)30-21(33)15-5-3-4-6-18(15)32(19)22(34)24(26,27)28/h7-12,15,18H,2-6H2,1H3,(H,30,33)(H2,29,31,35)/t15-,18+/m1/s1 |
| InChIKey | YLTHPHXUGNXTJU-QAPCUYQASA-N |
| XLogP | 5.99 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |