C32H39Cl2N3O5 — CID 23726912
tert-butyl (3aS,5Z,10aS)-9-[(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-10-oxo-3,3a,4,7,8,10a-hexahydro-2H-pyrrolo[2,3-c]azonine-1-carboxylate (PubChem CID 23726912) has the molecular formula C32H39Cl2N3O5 and a molecular weight of 616.59 g/mol. Its IUPAC name is tert-butyl (3aS,5Z,10aS)-9-[(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-10-oxo-3,3a,4,7,8,10a-hexahydro-2H-pyrrolo[2,3-c]azonine-1-carboxylate.
| Compound Name | tert-butyl (3aS,5Z,10aS)-9-[(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-10-oxo-3,3a,4,7,8,10a-hexahydro-2H-pyrrolo[2,3-c]azonine-1-carboxylate |
|---|---|
| PubChem CID | 23726912 |
| Molecular Formula | C32H39Cl2N3O5 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | tert-butyl (3aS,5Z,10aS)-9-[(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-10-oxo-3,3a,4,7,8,10a-hexahydro-2H-pyrrolo[2,3-c]azonine-1-carboxylate |
| SMILES | CNC(=O)[C@H](Cc1ccc(OCc2c(Cl)cccc2Cl)cc1)N1CC/C=C\C[C@H]2CCN(C(=O)OC(C)(C)C)[C@@H]2C1=O |
| InChI | InChI=1S/C32H39Cl2N3O5/c1-32(2,3)42-31(40)37-18-16-22-9-6-5-7-17-36(30(39)28(22)37)27(29(38)35-4)19-21-12-14-23(15-13-21)41-20-24-25(33)10-8-11-26(24)34/h5-6,8,10-15,22,27-28H,7,9,16-20H2,1-4H3,(H,35,38)/b6-5-/t22-,27-,28-/m0/s1 |
| InChIKey | ONBUJCQKURUOTJ-BIGGWQFWSA-N |
| XLogP | 6.03 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|