C21H27NO7S2 — CID 23727252
[(2R,3S,4R,5S)-4-(benzylamino)-5-methoxy-3-(4-methylphenyl)sulfonyloxolan-2-yl]methyl methanesulfonate (PubChem CID 23727252) has the molecular formula C21H27NO7S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-(benzylamino)-5-methoxy-3-(4-methylphenyl)sulfonyloxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3S,4R,5S)-4-(benzylamino)-5-methoxy-3-(4-methylphenyl)sulfonyloxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 23727252 |
| Molecular Formula | C21H27NO7S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [(2R,3S,4R,5S)-4-(benzylamino)-5-methoxy-3-(4-methylphenyl)sulfonyloxolan-2-yl]methyl methanesulfonate |
| SMILES | CO[C@H]1O[C@H](COS(C)(=O)=O)[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@@H]1NCc1ccccc1 |
| InChI | InChI=1S/C21H27NO7S2/c1-15-9-11-17(12-10-15)31(25,26)20-18(14-28-30(3,23)24)29-21(27-2)19(20)22-13-16-7-5-4-6-8-16/h4-12,18-22H,13-14H2,1-3H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | QBHKIPCXEJAYGE-MHTWAQMVSA-N |
| XLogP | 1.64 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|