C22H17IO3 — CID 23727727
3'-iodo-5'-methoxy-2'-(4-methoxyphenyl)spiro[cyclohexa-2,5-diene-4,1'-indene]-1-one (PubChem CID 23727727) has the molecular formula C22H17IO3 and a molecular weight of 456.28 g/mol. Its IUPAC name is 3'-iodo-5'-methoxy-2'-(4-methoxyphenyl)spiro[cyclohexa-2,5-diene-4,1'-indene]-1-one.
| Compound Name | 3'-iodo-5'-methoxy-2'-(4-methoxyphenyl)spiro[cyclohexa-2,5-diene-4,1'-indene]-1-one |
|---|---|
| PubChem CID | 23727727 |
| Molecular Formula | C22H17IO3 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 3'-iodo-5'-methoxy-2'-(4-methoxyphenyl)spiro[cyclohexa-2,5-diene-4,1'-indene]-1-one |
| SMILES | COc1ccc(C2=C(I)c3cc(OC)ccc3C23C=CC(=O)C=C3)cc1 |
| InChI | InChI=1S/C22H17IO3/c1-25-16-5-3-14(4-6-16)20-21(23)18-13-17(26-2)7-8-19(18)22(20)11-9-15(24)10-12-22/h3-13H,1-2H3 |
| InChIKey | FWFJICUDRRPFJX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|