C17H15Cl4NO — CID 23727804
4,5,6,7-tetrachloro-2-(3-phenoxypropyl)-1,3-dihydroisoindole (PubChem CID 23727804) has the molecular formula C17H15Cl4NO and a molecular weight of 391.13 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-(3-phenoxypropyl)-1,3-dihydroisoindole.
| Compound Name | 4,5,6,7-tetrachloro-2-(3-phenoxypropyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 23727804 |
| Molecular Formula | C17H15Cl4NO |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-(3-phenoxypropyl)-1,3-dihydroisoindole |
| SMILES | Clc1c(Cl)c(Cl)c2c(c1Cl)CN(CCCOc1ccccc1)C2 |
| InChI | InChI=1S/C17H15Cl4NO/c18-14-12-9-22(10-13(12)15(19)17(21)16(14)20)7-4-8-23-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2 |
| InChIKey | FDNIGSIZROVVJH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|