C22H36O5 — CID 23728756
dimethyl (4Z,12S,13S)-4,15,15-trimethyl-14-oxabicyclo[11.2.1]hexadec-4-ene-8,12-dicarboxylate (PubChem CID 23728756) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is dimethyl (4Z,12S,13S)-4,15,15-trimethyl-14-oxabicyclo[11.2.1]hexadec-4-ene-8,12-dicarboxylate.
| Compound Name | dimethyl (4Z,12S,13S)-4,15,15-trimethyl-14-oxabicyclo[11.2.1]hexadec-4-ene-8,12-dicarboxylate |
|---|---|
| PubChem CID | 23728756 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | dimethyl (4Z,12S,13S)-4,15,15-trimethyl-14-oxabicyclo[11.2.1]hexadec-4-ene-8,12-dicarboxylate |
| SMILES | COC(=O)C1CC/C=C(/C)CCC2C[C@H](OC2(C)C)[C@@H](C(=O)OC)CCC1 |
| InChI | InChI=1S/C22H36O5/c1-15-8-6-9-16(20(23)25-4)10-7-11-18(21(24)26-5)19-14-17(13-12-15)22(2,3)27-19/h8,16-19H,6-7,9-14H2,1-5H3/b15-8-/t16?,17?,18-,19-/m0/s1 |
| InChIKey | LLKYJPRIUKKHDS-JSMJDBPLSA-N |
| XLogP | 4.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|