C20H20N4O3 — CID 23729165
5-hydroxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one (PubChem CID 23729165) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-hydroxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one.
| Compound Name | 5-hydroxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 23729165 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-hydroxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
| SMILES | O=c1c2cc(O)ccc2n2cnc3ccc(NCCN4CCOCC4)c1c32 |
| InChI | InChI=1S/C20H20N4O3/c25-13-1-4-17-14(11-13)20(26)18-15(2-3-16-19(18)24(17)12-22-16)21-5-6-23-7-9-27-10-8-23/h1-4,11-12,21,25H,5-10H2 |
| InChIKey | HSKAJLPRNBADMX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|