C25H32N6O — CID 23655119
10-[3-[4-(3-aminopropyl)piperazin-1-yl]propylamino]-5-methyl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one (PubChem CID 23655119) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is 10-[3-[4-(3-aminopropyl)piperazin-1-yl]propylamino]-5-methyl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one.
| Compound Name | 10-[3-[4-(3-aminopropyl)piperazin-1-yl]propylamino]-5-methyl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 23655119 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 10-[3-[4-(3-aminopropyl)piperazin-1-yl]propylamino]-5-methyl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
| SMILES | Cc1ccc2c(c1)c(=O)c1c(NCCCN3CCN(CCCN)CC3)ccc3ncn2c31 |
| InChI | InChI=1S/C25H32N6O/c1-18-4-7-22-19(16-18)25(32)23-20(5-6-21-24(23)31(22)17-28-21)27-9-3-11-30-14-12-29(13-15-30)10-2-8-26/h4-7,16-17,27H,2-3,8-15,26H2,1H3 |
| InChIKey | JGDIPEQXPOCVKA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|