C28H35N7O9 — CID 23730224
2-[5-[(1S)-1-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-phenylmethoxyethyl]tetrazol-1-yl]ethyl (4-nitrophenyl) carbonate (PubChem CID 23730224) has the molecular formula C28H35N7O9 and a molecular weight of 613.63 g/mol. Its IUPAC name is 2-[5-[(1S)-1-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-phenylmethoxyethyl]tetrazol-1-yl]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[5-[(1S)-1-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-phenylmethoxyethyl]tetrazol-1-yl]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 23730224 |
| Molecular Formula | C28H35N7O9 |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 2-[5-[(1S)-1-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-phenylmethoxyethyl]tetrazol-1-yl]ethyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)N[C@H](COCc1ccccc1)c1nnnn1CCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H35N7O9/c1-27(2,3)44-25(37)30-28(4,5)24(36)29-22(18-41-17-19-9-7-6-8-10-19)23-31-32-33-34(23)15-16-42-26(38)43-21-13-11-20(12-14-21)35(39)40/h6-14,22H,15-18H2,1-5H3,(H,29,36)(H,30,37)/t22-/m1/s1 |
| InChIKey | VKAZILZDHMKGPA-JOCHJYFZSA-N |
| XLogP | 3.47 |
| TPSA | 198.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|