C10H11IN2O3 — CID 23731158
1-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-(124I)iodopyrimidine-2,4-dione (PubChem CID 23731158) has the molecular formula C10H11IN2O3 and a molecular weight of 331.12 g/mol. Its IUPAC name is 1-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-(124I)iodopyrimidine-2,4-dione.
| Compound Name | 1-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-(124I)iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23731158 |
| Molecular Formula | C10H11IN2O3 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 1-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-(124I)iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C=C[C@@H](CO)C2)cc1[124I] |
| InChI | InChI=1S/C10H11IN2O3/c11-8-4-13(10(16)12-9(8)15)7-2-1-6(3-7)5-14/h1-2,4,6-7,14H,3,5H2,(H,12,15,16)/t6-,7+/m1/s1/i11-3 |
| InChIKey | FIGOIHRJINUHNT-PIBQXFTLSA-N |
| XLogP | 0.25 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|