C12H16N2O3 — CID 89476260
1-[(1S,5S)-4-(deuteriomethyl)-5-hydroxycyclohex-2-en-1-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 89476260) has the molecular formula C12H16N2O3 and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-[(1S,5S)-4-(deuteriomethyl)-5-hydroxycyclohex-2-en-1-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,5S)-4-(deuteriomethyl)-5-hydroxycyclohex-2-en-1-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89476260 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-[(1S,5S)-4-(deuteriomethyl)-5-hydroxycyclohex-2-en-1-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [2H]CC1C=C[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C12H16N2O3/c1-7-3-4-9(5-10(7)15)14-6-8(2)11(16)13-12(14)17/h3-4,6-7,9-10,15H,5H2,1-2H3,(H,13,16,17)/t7?,9-,10+/m1/s1/i1D |
| InChIKey | AJVCGOCXRKHAAI-XQIYOWKFSA-N |
| XLogP | 0.34 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|