C21H13N5S — CID 23731480
13-amino-11-(4-methylphenyl)-15-thia-8,9,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,13,16-octaene-14-carbonitrile (PubChem CID 23731480) has the molecular formula C21H13N5S and a molecular weight of 367.44 g/mol. Its IUPAC name is 13-amino-11-(4-methylphenyl)-15-thia-8,9,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,13,16-octaene-14-carbonitrile.
| Compound Name | 13-amino-11-(4-methylphenyl)-15-thia-8,9,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,13,16-octaene-14-carbonitrile |
|---|---|
| PubChem CID | 23731480 |
| Molecular Formula | C21H13N5S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 13-amino-11-(4-methylphenyl)-15-thia-8,9,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,11,13,16-octaene-14-carbonitrile |
| SMILES | Cc1ccc(-c2c3nnc4ccccc4c3nc3sc(C#N)c(N)c23)cc1 |
| InChI | InChI=1S/C21H13N5S/c1-11-6-8-12(9-7-11)16-17-18(23)15(10-22)27-21(17)24-19-13-4-2-3-5-14(13)25-26-20(16)19/h2-9H,23H2,1H3 |
| InChIKey | QCQRUGWJQNYNCJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|