C23H36N6O3 — CID 23733637
3-amino-N-(4-aminocyclohexyl)-4-[4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 23733637) has the molecular formula C23H36N6O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 3-amino-N-(4-aminocyclohexyl)-4-[4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 3-amino-N-(4-aminocyclohexyl)-4-[4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 23733637 |
| Molecular Formula | C23H36N6O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 3-amino-N-(4-aminocyclohexyl)-4-[4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | Nc1cc(C(=O)NC2CCC(N)CC2)ccc1N1CCCN(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C23H36N6O3/c24-18-3-5-19(6-4-18)26-22(30)17-2-7-21(20(25)16-17)27-8-1-9-28(11-10-27)23(31)29-12-14-32-15-13-29/h2,7,16,18-19H,1,3-6,8-15,24-25H2,(H,26,30) |
| InChIKey | JVBWIKSJDTYJHQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|