C21H24N2O4 — CID 23734961
6,7-dimethoxy-1-(2-nitrophenyl)spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopentane] (PubChem CID 23734961) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(2-nitrophenyl)spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopentane].
| Compound Name | 6,7-dimethoxy-1-(2-nitrophenyl)spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopentane] |
|---|---|
| PubChem CID | 23734961 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6,7-dimethoxy-1-(2-nitrophenyl)spiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopentane] |
| SMILES | COc1cc2c(cc1OC)C1(CCCC1)CNC2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O4/c1-26-18-11-15-16(12-19(18)27-2)21(9-5-6-10-21)13-22-20(15)14-7-3-4-8-17(14)23(24)25/h3-4,7-8,11-12,20,22H,5-6,9-10,13H2,1-2H3 |
| InChIKey | VXAMUCUDSGCBMJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|