C24H27N3O6 — CID 46734189
6,7-dimethoxy-N-methyl-2-(4-nitrobenzoyl)spiro[1,3-dihydroisoquinoline-4,1'-cyclopentane]-1-carboxamide (PubChem CID 46734189) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 6,7-dimethoxy-N-methyl-2-(4-nitrobenzoyl)spiro[1,3-dihydroisoquinoline-4,1'-cyclopentane]-1-carboxamide.
| Compound Name | 6,7-dimethoxy-N-methyl-2-(4-nitrobenzoyl)spiro[1,3-dihydroisoquinoline-4,1'-cyclopentane]-1-carboxamide |
|---|---|
| PubChem CID | 46734189 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 6,7-dimethoxy-N-methyl-2-(4-nitrobenzoyl)spiro[1,3-dihydroisoquinoline-4,1'-cyclopentane]-1-carboxamide |
| SMILES | CNC(=O)C1c2cc(OC)c(OC)cc2C2(CCCC2)CN1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H27N3O6/c1-25-22(28)21-17-12-19(32-2)20(33-3)13-18(17)24(10-4-5-11-24)14-26(21)23(29)15-6-8-16(9-7-15)27(30)31/h6-9,12-13,21H,4-5,10-11,14H2,1-3H3,(H,25,28) |
| InChIKey | GLBGMICBBUHBII-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|