C21H25N2O4+ — CID 6966447
(1R)-6,7-dimethoxy-1-(4-nitrophenyl)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane] (PubChem CID 6966447) has the molecular formula C21H25N2O4+ and a molecular weight of 369.44 g/mol. Its IUPAC name is (1R)-6,7-dimethoxy-1-(4-nitrophenyl)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane].
| Compound Name | (1R)-6,7-dimethoxy-1-(4-nitrophenyl)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane] |
|---|---|
| PubChem CID | 6966447 |
| Molecular Formula | C21H25N2O4+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (1R)-6,7-dimethoxy-1-(4-nitrophenyl)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,1'-cyclopentane] |
| SMILES | COc1cc2c(cc1OC)C1(CCCC1)C[NH2+][C@@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-26-18-11-16-17(12-19(18)27-2)21(9-3-4-10-21)13-22-20(16)14-5-7-15(8-6-14)23(24)25/h5-8,11-12,20,22H,3-4,9-10,13H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | KVEIQKZBFJMKFL-HXUWFJFHSA-O |
| XLogP | 3.09 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|