C17H17NO5 — CID 101436281
(1S)-7-methoxy-1-(4-nitrophenyl)-1,3,4,5-tetrahydro-2-benzoxepin-8-ol (PubChem CID 101436281) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is (1S)-7-methoxy-1-(4-nitrophenyl)-1,3,4,5-tetrahydro-2-benzoxepin-8-ol.
| Compound Name | (1S)-7-methoxy-1-(4-nitrophenyl)-1,3,4,5-tetrahydro-2-benzoxepin-8-ol |
|---|---|
| PubChem CID | 101436281 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (1S)-7-methoxy-1-(4-nitrophenyl)-1,3,4,5-tetrahydro-2-benzoxepin-8-ol |
| SMILES | COc1cc2c(cc1O)[C@H](c1ccc([N+](=O)[O-])cc1)OCCC2 |
| InChI | InChI=1S/C17H17NO5/c1-22-16-9-12-3-2-8-23-17(14(12)10-15(16)19)11-4-6-13(7-5-11)18(20)21/h4-7,9-10,17,19H,2-3,8H2,1H3/t17-/m0/s1 |
| InChIKey | PGQSWVZASIICGC-KRWDZBQOSA-N |
| XLogP | 3.36 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|