C31H29N5OS2 — CID 23738687
1-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 23738687) has the molecular formula C31H29N5OS2 and a molecular weight of 551.74 g/mol. Its IUPAC name is 1-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 23738687 |
| Molecular Formula | C31H29N5OS2 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 1-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | Cc1ccccc1Nc1nnc(SCC(=O)N2N=C3C(=Cc4ccccc4)CCCC3C2c2ccccc2)s1 |
| InChI | InChI=1S/C31H29N5OS2/c1-21-11-8-9-18-26(21)32-30-33-34-31(39-30)38-20-27(37)36-29(23-14-6-3-7-15-23)25-17-10-16-24(28(25)35-36)19-22-12-4-2-5-13-22/h2-9,11-15,18-19,25,29H,10,16-17,20H2,1H3,(H,32,33) |
| InChIKey | DFUAMHBNBXQMBF-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |