C26H25N5O3S2 — CID 3525465
[2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate (PubChem CID 3525465) has the molecular formula C26H25N5O3S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is [2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate.
| Compound Name | [2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 3525465 |
| Molecular Formula | C26H25N5O3S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [2-(7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
| SMILES | Nc1nnc(SCC(=O)OCC(=O)N2N=C3C(=Cc4ccccc4)CCCC3C2c2ccccc2)s1 |
| InChI | InChI=1S/C26H25N5O3S2/c27-25-28-29-26(36-25)35-16-22(33)34-15-21(32)31-24(18-10-5-2-6-11-18)20-13-7-12-19(23(20)30-31)14-17-8-3-1-4-9-17/h1-6,8-11,14,20,24H,7,12-13,15-16H2,(H2,27,28) |
| InChIKey | WQCSPVGHKVVZDO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |