C17H16Cl2N2O4 — CID 23745021
[1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate (PubChem CID 23745021) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 23745021 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | [1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
| SMILES | CCC(OC(=O)c1cccnc1Cl)C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-3-13(25-17(23)11-5-4-8-20-15(11)19)16(22)21-12-9-10(18)6-7-14(12)24-2/h4-9,13H,3H2,1-2H3,(H,21,22) |
| InChIKey | GTJNSTWKEDCWFV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|