C20H18ClN3O3 — CID 23944297
[1-[(2-methylquinolin-4-yl)amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate (PubChem CID 23944297) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is [1-[(2-methylquinolin-4-yl)amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [1-[(2-methylquinolin-4-yl)amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 23944297 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [1-[(2-methylquinolin-4-yl)amino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
| SMILES | CCC(OC(=O)c1cccnc1Cl)C(=O)Nc1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C20H18ClN3O3/c1-3-17(27-20(26)14-8-6-10-22-18(14)21)19(25)24-16-11-12(2)23-15-9-5-4-7-13(15)16/h4-11,17H,3H2,1-2H3,(H,23,24,25) |
| InChIKey | GODFMGSUFXMOMY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|