C28H36ClN3O4S — CID 23754182
(5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754182) has the molecular formula C28H36ClN3O4S and a molecular weight of 546.13 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754182 |
| Molecular Formula | C28H36ClN3O4S |
| Molecular Weight | 546.13 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | (5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CC)CO)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C28H36ClN3O4S/c1-6-15-30(5)24(34)21-22-25(35)32(18(8-3)17-33)23(28(22)14-13-27(21,4)37-28)26(36)31(16-7-2)20-12-10-9-11-19(20)29/h6-7,9-12,18,21-23,33H,1-2,8,13-17H2,3-5H3/t18-,21+,22-,23?,27-,28?/m0/s1 |
| InChIKey | DYFKGGPUJQTYEN-APEFJRTISA-N |
| XLogP | 3.76 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|