C34H50N4O4S — CID 23783201
(5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783201) has the molecular formula C34H50N4O4S and a molecular weight of 610.87 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783201 |
| Molecular Formula | C34H50N4O4S |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N(C(CO)CC(C)C)C(C(=O)N(CC=C)c3ccc(N(CC)CC)cc3)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C34H50N4O4S/c1-9-19-35(8)30(40)27-28-31(41)38(26(22-39)21-23(5)6)29(34(28)18-17-33(27,7)43-34)32(42)37(20-10-2)25-15-13-24(14-16-25)36(11-3)12-4/h9-10,13-16,23,26-29,39H,1-2,11-12,17-22H2,3-8H3/t26?,27-,28+,29?,33+,34?/m1/s1 |
| InChIKey | MXVBDDDSNCOKHT-HEFHNSICSA-N |
| XLogP | 4.58 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|