C28H44BrN3O5 — CID 23755254
(5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23755254) has the molecular formula C28H44BrN3O5 and a molecular weight of 582.58 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23755254 |
| Molecular Formula | C28H44BrN3O5 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)C(C)C)C(C(=O)N(CC=C)C(C)(C)C)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C28H44BrN3O5/c1-9-12-30(13-10-2)24(34)20-21-25(35)32(19(16-33)17(4)5)23(28(21)15-18(29)22(20)37-28)26(36)31(14-11-3)27(6,7)8/h9,11,17-23,33H,1,3,10,12-16H2,2,4-8H3/t18?,19-,20-,21-,22-,23?,28?/m0/s1 |
| InChIKey | BBIKUFJUQLKYIR-OERAUGRASA-N |
| XLogP | 2.99 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|