C21H22F3N2O5P — CID 23757340
(3Z)-3-dimethoxyphosphorylimino-1-ethenyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,4-dihydroisoquinolin-7-ol (PubChem CID 23757340) has the molecular formula C21H22F3N2O5P and a molecular weight of 470.38 g/mol. Its IUPAC name is (3Z)-3-dimethoxyphosphorylimino-1-ethenyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,4-dihydroisoquinolin-7-ol.
| Compound Name | (3Z)-3-dimethoxyphosphorylimino-1-ethenyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,4-dihydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 23757340 |
| Molecular Formula | C21H22F3N2O5P |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (3Z)-3-dimethoxyphosphorylimino-1-ethenyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,4-dihydroisoquinolin-7-ol |
| SMILES | C=CC1c2cc(O)ccc2C/C(=N/P(=O)(OC)OC)N1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N2O5P/c1-4-19-18-12-16(27)9-8-15(18)11-20(25-32(28,29-2)30-3)26(19)13-14-6-5-7-17(10-14)31-21(22,23)24/h4-10,12,19,27H,1,11,13H2,2-3H3/b25-20- |
| InChIKey | MYDJRJXDRVHVND-QQTULTPQSA-N |
| XLogP | 5.38 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|