C26H26F3N2O5PS — CID 23749470
[4-[(6Z)-6-dimethoxyphosphorylimino-2-thiophen-2-yl-1-[[3-(trifluoromethoxy)phenyl]methyl]-2,5-dihydropyridin-4-yl]phenyl]methanol (PubChem CID 23749470) has the molecular formula C26H26F3N2O5PS and a molecular weight of 566.54 g/mol. Its IUPAC name is [4-[(6Z)-6-dimethoxyphosphorylimino-2-thiophen-2-yl-1-[[3-(trifluoromethoxy)phenyl]methyl]-2,5-dihydropyridin-4-yl]phenyl]methanol.
| Compound Name | [4-[(6Z)-6-dimethoxyphosphorylimino-2-thiophen-2-yl-1-[[3-(trifluoromethoxy)phenyl]methyl]-2,5-dihydropyridin-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 23749470 |
| Molecular Formula | C26H26F3N2O5PS |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [4-[(6Z)-6-dimethoxyphosphorylimino-2-thiophen-2-yl-1-[[3-(trifluoromethoxy)phenyl]methyl]-2,5-dihydropyridin-4-yl]phenyl]methanol |
| SMILES | COP(=O)(/N=C1/CC(c2ccc(CO)cc2)=CC(c2cccs2)N1Cc1cccc(OC(F)(F)F)c1)OC |
| InChI | InChI=1S/C26H26F3N2O5PS/c1-34-37(33,35-2)30-25-15-21(20-10-8-18(17-32)9-11-20)14-23(24-7-4-12-38-24)31(25)16-19-5-3-6-22(13-19)36-26(27,28)29/h3-14,23,32H,15-17H2,1-2H3/b30-25- |
| InChIKey | FZHMRECJZPRSOS-JVCXMKTPSA-N |
| XLogP | 6.97 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|