C29H35N9O3 — CID 23758198
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(benzylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 23758198) has the molecular formula C29H35N9O3 and a molecular weight of 557.66 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(benzylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(benzylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 23758198 |
| Molecular Formula | C29H35N9O3 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-[[4-(benzylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | NCCOCCOCCNC(=O)c1cccc(Nc2nc(NCc3ccccc3)nc(NCc3ccccn3)n2)c1 |
| InChI | InChI=1S/C29H35N9O3/c30-12-15-40-17-18-41-16-14-32-26(39)23-9-6-11-24(19-23)35-29-37-27(33-20-22-7-2-1-3-8-22)36-28(38-29)34-21-25-10-4-5-13-31-25/h1-11,13,19H,12,14-18,20-21,30H2,(H,32,39)(H3,33,34,35,36,37,38) |
| InChIKey | NLMQUEPMZYIIRB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|