C31H36N4O7 — CID 23760384
N-[(E)-[3-[[(1R,6E,12R)-3,10-dioxo-2-oxa-11-azabicyclo[10.4.0]hexadec-6-en-11-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide (PubChem CID 23760384) has the molecular formula C31H36N4O7 and a molecular weight of 576.65 g/mol. Its IUPAC name is N-[(E)-[3-[[(1R,6E,12R)-3,10-dioxo-2-oxa-11-azabicyclo[10.4.0]hexadec-6-en-11-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide.
| Compound Name | N-[(E)-[3-[[(1R,6E,12R)-3,10-dioxo-2-oxa-11-azabicyclo[10.4.0]hexadec-6-en-11-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 23760384 |
| Molecular Formula | C31H36N4O7 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | N-[(E)-[3-[[(1R,6E,12R)-3,10-dioxo-2-oxa-11-azabicyclo[10.4.0]hexadec-6-en-11-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1cccc(C(=O)N/N=C/c2cccc(CN3C(=O)CC/C=C/CCC(=O)O[C@@H]4CCCC[C@H]43)c2)c1)NO |
| InChI | InChI=1S/C31H36N4O7/c36-28(34-40)21-41-25-12-8-11-24(18-25)31(39)33-32-19-22-9-7-10-23(17-22)20-35-26-13-5-6-14-27(26)42-30(38)16-4-2-1-3-15-29(35)37/h1-2,7-12,17-19,26-27,40H,3-6,13-16,20-21H2,(H,33,39)(H,34,36)/b2-1+,32-19+/t26-,27-/m1/s1 |
| InChIKey | JRBHGLQBORPKME-MQSXLRCASA-N |
| XLogP | 3.65 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|