C33H34N4O7 — CID 23789320
N-[(E)-[4-[[(2S,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide (PubChem CID 23789320) has the molecular formula C33H34N4O7 and a molecular weight of 598.66 g/mol. Its IUPAC name is N-[(E)-[4-[[(2S,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide.
| Compound Name | N-[(E)-[4-[[(2S,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 23789320 |
| Molecular Formula | C33H34N4O7 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-[(E)-[4-[[(2S,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]-3-[2-(hydroxyamino)-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1cccc(C(=O)N/N=C/c2ccc(CN3C[C@H](c4ccccc4)OC(=O)CC/C=C/CCC3=O)cc2)c1)NO |
| InChI | InChI=1S/C33H34N4O7/c38-30(36-42)23-43-28-12-8-11-27(19-28)33(41)35-34-20-24-15-17-25(18-16-24)21-37-22-29(26-9-4-3-5-10-26)44-32(40)14-7-2-1-6-13-31(37)39/h1-5,8-12,15-20,29,42H,6-7,13-14,21-23H2,(H,35,41)(H,36,38)/b2-1+,34-20+/t29-/m1/s1 |
| InChIKey | UGZSYJSUHXFAGT-YFQKJVHASA-N |
| XLogP | 4.08 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|