C34H44N4O7 — CID 23760386
N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]octanediamide (PubChem CID 23760386) has the molecular formula C34H44N4O7 and a molecular weight of 620.75 g/mol. Its IUPAC name is N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]octanediamide.
| Compound Name | N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]octanediamide |
|---|---|
| PubChem CID | 23760386 |
| Molecular Formula | C34H44N4O7 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]octanediamide |
| SMILES | COC[C@H]1[C@H](c2ccccc2)OC(=O)CC/C=C/CCC(=O)N1Cc1ccc(/C=N/NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C34H44N4O7/c1-44-25-29-34(28-13-7-6-8-14-28)45-33(42)18-12-5-4-11-17-32(41)38(29)24-27-21-19-26(20-22-27)23-35-36-30(39)15-9-2-3-10-16-31(40)37-43/h4-8,13-14,19-23,29,34,43H,2-3,9-12,15-18,24-25H2,1H3,(H,36,39)(H,37,40)/b5-4+,35-23+/t29-,34-/m0/s1 |
| InChIKey | PQCXIEPPICIGIM-CIMIUESNSA-N |
| XLogP | 4.74 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|