C24H25NO4 — CID 23760371
4-[[(3S,8E)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]benzaldehyde (PubChem CID 23760371) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[[(3S,8E)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]benzaldehyde.
| Compound Name | 4-[[(3S,8E)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 23760371 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-[[(3S,8E)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(CN2C(=O)CC/C=C/CCC(=O)OC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO4/c26-17-20-14-12-19(13-15-20)16-25-22(21-8-4-3-5-9-21)18-29-24(28)11-7-2-1-6-10-23(25)27/h1-5,8-9,12-15,17,22H,6-7,10-11,16,18H2/b2-1+/t22-/m1/s1 |
| InChIKey | ULHNJXRODSMKIQ-RDUCDJESSA-N |
| XLogP | 4.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|